C20H18F3NO5 — CID 7767527
ethyl 4-[[2-[2-[3-(trifluoromethyl)phenyl]acetyl]oxyacetyl]amino]benzoate (PubChem CID 7767527) has the molecular formula C20H18F3NO5 and a molecular weight of 409.36 g/mol. Its IUPAC name is ethyl 4-[[2-[2-[3-(trifluoromethyl)phenyl]acetyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-[3-(trifluoromethyl)phenyl]acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7767527 |
| Molecular Formula | C20H18F3NO5 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | ethyl 4-[[2-[2-[3-(trifluoromethyl)phenyl]acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H18F3NO5/c1-2-28-19(27)14-6-8-16(9-7-14)24-17(25)12-29-18(26)11-13-4-3-5-15(10-13)20(21,22)23/h3-10H,2,11-12H2,1H3,(H,24,25) |
| InChIKey | JVEDLCVLWKGSRC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |