C19H18FNO5 — CID 7759306
ethyl 4-[[2-[2-(4-fluorophenyl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 7759306) has the molecular formula C19H18FNO5 and a molecular weight of 359.35 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(4-fluorophenyl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-(4-fluorophenyl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7759306 |
| Molecular Formula | C19H18FNO5 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | ethyl 4-[[2-[2-(4-fluorophenyl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H18FNO5/c1-2-25-19(24)14-5-9-16(10-6-14)21-17(22)12-26-18(23)11-13-3-7-15(20)8-4-13/h3-10H,2,11-12H2,1H3,(H,21,22) |
| InChIKey | UWIJXNLTOZKBRT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |