C19H17Cl2NO5 — CID 7767309
ethyl 4-[[2-[2-(2,6-dichlorophenyl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 7767309) has the molecular formula C19H17Cl2NO5 and a molecular weight of 410.25 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(2,6-dichlorophenyl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-(2,6-dichlorophenyl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7767309 |
| Molecular Formula | C19H17Cl2NO5 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | ethyl 4-[[2-[2-(2,6-dichlorophenyl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)Cc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2NO5/c1-2-26-19(25)12-6-8-13(9-7-12)22-17(23)11-27-18(24)10-14-15(20)4-3-5-16(14)21/h3-9H,2,10-11H2,1H3,(H,22,23) |
| InChIKey | VETPKCLWEPDGKR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |