C11H11Cl2NO3 — CID 8001276
[2-(methylamino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate (PubChem CID 8001276) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 8001276 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate |
| SMILES | CNC(=O)COC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3/c1-14-10(15)6-17-11(16)5-7-8(12)3-2-4-9(7)13/h2-4H,5-6H2,1H3,(H,14,15) |
| InChIKey | QBMCLQDRRVIIOM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |