About [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate
[2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate (PubChem CID 2349915) has the molecular formula C17H13Cl4NO3
and a molecular weight of 421.10 g/mol. Its IUPAC name is [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate |
| PubChem CID | 2349915 |
| Molecular Formula | C17H13Cl4NO3 |
| Molecular Weight | 421.10 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate |
| SMILES | CC1=C(C(=C(C=C1)Cl)NC(=O)COC(=O)CC2=C(C=CC=C2Cl)Cl)Cl |
| InChI | InChI=1S/C17H13Cl4NO3/c1-9-5-6-13(20)17(16(9)21)22-14(23)8-25-15(24)7-10-11(18)3-2-4-12(10)19/h2-6H,7-8H2,1H3,(H,22,23) |
| InChIKey | WVECXYFEDRCWEO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | 469 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.10 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
The IUPAC name of [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate (CID 2349915) is [2-(2,6-dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate.
What is the SMILES notation for [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
The canonical SMILES for [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate is CC1=C(C(=C(C=C1)Cl)NC(=O)COC(=O)CC2=C(C=CC=C2Cl)Cl)Cl.
What is the InChIKey of [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
The InChIKey is WVECXYFEDRCWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl4NO3/c1-9-5-6-13(20)17(16(9)21)22-14(23)8-25-15(24)7-10-11(18)3-2-4-12(10)19/h2-6H,7-8H2,1H3,(H,22,23).
What are the key properties of [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate?
[2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate has a molecular weight of 421.10 g/mol, XLogP of 5.50, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-Dichloro-3-methylanilino)-2-oxoethyl] 2-(2,6-dichlorophenyl)acetate is sourced from PubChem (CID 2349915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).