About [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate
[2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate (PubChem CID 61321081) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate.
Molecular Properties
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate |
| PubChem CID | 61321081 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate |
| SMILES | CNC(=O)COC(=O)Cc1ccccc1N |
| InChI | InChI=1S/C11H14N2O3/c1-13-10(14)7-16-11(15)6-8-4-2-3-5-9(8)12/h2-5H,6-7,12H2,1H3,(H,13,14) |
| InChIKey | ICZBDCYHEUGELZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate?
The IUPAC name of [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate (CID 61321081) is [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate.
What is the SMILES notation for [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate?
The canonical SMILES for [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate is CNC(=O)COC(=O)Cc1ccccc1N.
What is the InChIKey of [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate?
The InChIKey is ICZBDCYHEUGELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-13-10(14)7-16-11(15)6-8-4-2-3-5-9(8)12/h2-5H,6-7,12H2,1H3,(H,13,14).
What are the key properties of [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate?
[2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate has a molecular weight of 222.24 g/mol, XLogP of 0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)-2-oxoethyl] 2-(2-aminophenyl)acetate is sourced from PubChem (CID 61321081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).