C10H13NO4 — CID 78763973
[2-(methylamino)-2-oxoethyl] 3-(furan-2-yl)propanoate (PubChem CID 78763973) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 3-(furan-2-yl)propanoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 78763973 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 3-(furan-2-yl)propanoate |
| SMILES | CNC(=O)COC(=O)CCc1ccco1 |
| InChI | InChI=1S/C10H13NO4/c1-11-9(12)7-15-10(13)5-4-8-3-2-6-14-8/h2-3,6H,4-5,7H2,1H3,(H,11,12) |
| InChIKey | LCGKPZKUMADENU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |