C14H21N3O5 — CID 8859315
[2-(furan-2-ylmethylamino)-2-oxoethyl] 6-(carbamoylamino)hexanoate (PubChem CID 8859315) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 6-(carbamoylamino)hexanoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8859315 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 6-(carbamoylamino)hexanoate |
| SMILES | NC(=O)NCCCCCC(=O)OCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H21N3O5/c15-14(20)16-7-3-1-2-6-13(19)22-10-12(18)17-9-11-5-4-8-21-11/h4-5,8H,1-3,6-7,9-10H2,(H,17,18)(H3,15,16,20) |
| InChIKey | OUZYUYXWRGDEJZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|