C15H25N2O7P — CID 101203083
6-[[4-(furan-2-ylmethylamino)-4-oxobutanoyl]amino]hexyl dihydrogen phosphate (PubChem CID 101203083) has the molecular formula C15H25N2O7P and a molecular weight of 376.35 g/mol. Its IUPAC name is 6-[[4-(furan-2-ylmethylamino)-4-oxobutanoyl]amino]hexyl dihydrogen phosphate.
| Compound Name | 6-[[4-(furan-2-ylmethylamino)-4-oxobutanoyl]amino]hexyl dihydrogen phosphate |
|---|---|
| PubChem CID | 101203083 |
| Molecular Formula | C15H25N2O7P |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 6-[[4-(furan-2-ylmethylamino)-4-oxobutanoyl]amino]hexyl dihydrogen phosphate |
| SMILES | O=C(CCC(=O)NCc1ccco1)NCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C15H25N2O7P/c18-14(7-8-15(19)17-12-13-6-5-10-23-13)16-9-3-1-2-4-11-24-25(20,21)22/h5-6,10H,1-4,7-9,11-12H2,(H,16,18)(H,17,19)(H2,20,21,22) |
| InChIKey | ULFNZXOUFVPADY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|