C8H11NO3 — CID 82111306
N-(furan-2-ylmethyl)-3-hydroxypropanamide (PubChem CID 82111306) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-hydroxypropanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 82111306 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-hydroxypropanamide |
| SMILES | O=C(CCO)NCc1ccco1 |
| InChI | InChI=1S/C8H11NO3/c10-4-3-8(11)9-6-7-2-1-5-12-7/h1-2,5,10H,3-4,6H2,(H,9,11) |
| InChIKey | VKIANBPSFWKNQH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |