C9H13NO4S — CID 123117257
N-(furan-2-ylmethyl)-2-(2-hydroxyethylsulfinyl)acetamide (PubChem CID 123117257) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(2-hydroxyethylsulfinyl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(2-hydroxyethylsulfinyl)acetamide |
|---|---|
| PubChem CID | 123117257 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(2-hydroxyethylsulfinyl)acetamide |
| SMILES | O=C(CS(=O)CCO)NCc1ccco1 |
| InChI | InChI=1S/C9H13NO4S/c11-3-5-15(13)7-9(12)10-6-8-2-1-4-14-8/h1-2,4,11H,3,5-7H2,(H,10,12) |
| InChIKey | PGPKJKDPUPNMAR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |