C15H15NO5S — CID 123109670
3-[[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfinylmethyl]benzoic acid (PubChem CID 123109670) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 3-[[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfinylmethyl]benzoic acid.
| Compound Name | 3-[[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123109670 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-[[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfinylmethyl]benzoic acid |
| SMILES | O=C(CS(=O)Cc1cccc(C(=O)O)c1)NCc1ccco1 |
| InChI | InChI=1S/C15H15NO5S/c17-14(16-8-13-5-2-6-21-13)10-22(20)9-11-3-1-4-12(7-11)15(18)19/h1-7H,8-10H2,(H,16,17)(H,18,19) |
| InChIKey | BRJXEBMDEGPBIZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |