C17H16ClNO4S — CID 123109615
3-[[2-(5-chloro-2-methylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid (PubChem CID 123109615) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is 3-[[2-(5-chloro-2-methylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid.
| Compound Name | 3-[[2-(5-chloro-2-methylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123109615 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 3-[[2-(5-chloro-2-methylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CS(=O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H16ClNO4S/c1-11-5-6-14(18)8-15(11)19-16(20)10-24(23)9-12-3-2-4-13(7-12)17(21)22/h2-8H,9-10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | OFSQRBJVFOWNQE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |