C16H16O3S — CID 60710388
3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid (PubChem CID 60710388) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 60710388 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)Cc2cccc(C(=O)O)c2)cc1C |
| InChI | InChI=1S/C16H16O3S/c1-11-6-7-15(8-12(11)2)20(19)10-13-4-3-5-14(9-13)16(17)18/h3-9H,10H2,1-2H3,(H,17,18) |
| InChIKey | JEIUTJQTBGGHEQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |