3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid

C16H16O3S — CID 60710388

IUPAC3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid
SMILESCc1ccc(S(=O)Cc2cccc(C(=O)O)c2)cc1C
InChIInChI=1S/C16H16O3S/c1-11-6-7-15(8-12(11)2)20(19)10-13-4-3-5-14(9-13)16(17)18/h3-9H,10H2,1-2H3,(H,17,18)
InChIKeyJEIUTJQTBGGHEQ-UHFFFAOYSA-N
MW288.37 g/mol
LogP3.31
Rot. Bonds4

About 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid

3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid (PubChem CID 60710388) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid.

Molecular Properties

Compound Name3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid
PubChem CID60710388
Molecular FormulaC16H16O3S
Molecular Weight288.37 g/mol
Exact Mass288.08
IUPAC Name3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid
SMILESCc1ccc(S(=O)Cc2cccc(C(=O)O)c2)cc1C
InChIInChI=1S/C16H16O3S/c1-11-6-7-15(8-12(11)2)20(19)10-13-4-3-5-14(9-13)16(17)18/h3-9H,10H2,1-2H3,(H,17,18)
InChIKeyJEIUTJQTBGGHEQ-UHFFFAOYSA-N
XLogP3.31
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.37
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid?
The IUPAC name of 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid (CID 60710388) is 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid.
What is the SMILES notation for 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid?
The canonical SMILES for 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid is Cc1ccc(S(=O)Cc2cccc(C(=O)O)c2)cc1C.
What is the InChIKey of 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid?
The InChIKey is JEIUTJQTBGGHEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3S/c1-11-6-7-15(8-12(11)2)20(19)10-13-4-3-5-14(9-13)16(17)18/h3-9H,10H2,1-2H3,(H,17,18).
What are the key properties of 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid?
3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid has a molecular weight of 288.37 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethylphenyl)sulfinylmethyl]benzoic acid is sourced from PubChem (CID 60710388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).