C18H18ClNO4S — CID 123109634
3-[[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid (PubChem CID 123109634) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 3-[[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid.
| Compound Name | 3-[[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123109634 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 3-[[1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]sulfinylmethyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)C(C)S(=O)Cc2cccc(C(=O)O)c2)cc1Cl |
| InChI | InChI=1S/C18H18ClNO4S/c1-11-6-7-15(9-16(11)19)20-17(21)12(2)25(24)10-13-4-3-5-14(8-13)18(22)23/h3-9,12H,10H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | NSVUKUKAQBZONO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |