C24H22ClNO4S — CID 55497579
[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(methylsulfinylmethyl)benzoate (PubChem CID 55497579) has the molecular formula C24H22ClNO4S and a molecular weight of 455.96 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(methylsulfinylmethyl)benzoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(methylsulfinylmethyl)benzoate |
|---|---|
| PubChem CID | 55497579 |
| Molecular Formula | C24H22ClNO4S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 3-(methylsulfinylmethyl)benzoate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)c2cccc(CS(C)=O)c2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H22ClNO4S/c1-16-11-12-20(14-21(16)25)26-23(27)22(18-8-4-3-5-9-18)30-24(28)19-10-6-7-17(13-19)15-31(2)29/h3-14,22H,15H2,1-2H3,(H,26,27) |
| InChIKey | MPYCEUIHEOFFNE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |