C20H16ClNO4 — CID 2631518
[(1S)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate (PubChem CID 2631518) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is [(1S)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate.
| Compound Name | [(1S)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2631518 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(1S)-2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@@H](OC(=O)c2ccco2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H16ClNO4/c1-13-9-10-15(12-16(13)21)22-19(23)18(14-6-3-2-4-7-14)26-20(24)17-8-5-11-25-17/h2-12,18H,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | HLLTUWGJAGOGIB-SFHVURJKSA-N |
| XLogP | 4.78 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |