C20H17NO5 — CID 2342352
[(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate (PubChem CID 2342352) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate.
| Compound Name | [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2342352 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate |
| SMILES | COc1cccc(NC(=O)[C@H](OC(=O)c2ccco2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H17NO5/c1-24-16-10-5-9-15(13-16)21-19(22)18(14-7-3-2-4-8-14)26-20(23)17-11-6-12-25-17/h2-13,18H,1H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | NNOCIAUTIDIDAI-GOSISDBHSA-N |
| XLogP | 3.83 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |