C25H21NO5 — CID 16506248
[2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 16506248) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16506248 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | COc1cccc(NC(=O)C(OC(=O)c2oc3ccccc3c2C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H21NO5/c1-16-20-13-6-7-14-21(20)30-22(16)25(28)31-23(17-9-4-3-5-10-17)24(27)26-18-11-8-12-19(15-18)29-2/h3-15,23H,1-2H3,(H,26,27) |
| InChIKey | YWBSNPYGKDPQNI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |