C18H15NO4 — CID 42897228
(2-amino-2-oxo-1-phenylethyl) 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 42897228) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 42897228 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C(N)=O)c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C18H15NO4/c1-11-13-9-5-6-10-14(13)22-15(11)18(21)23-16(17(19)20)12-7-3-2-4-8-12/h2-10,16H,1H3,(H2,19,20) |
| InChIKey | MUZOLCPOYGQFSD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |