C19H16O4 — CID 16577444
(1-oxo-1-phenylpropan-2-yl) 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 16577444) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16577444 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C19H16O4/c1-12-15-10-6-7-11-16(15)23-18(12)19(21)22-13(2)17(20)14-8-4-3-5-9-14/h3-11,13H,1-2H3 |
| InChIKey | HBNHQKGUXWUKIH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |