C21H20N2O5 — CID 8739108
[(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8739108) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8739108 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@@H](C)C(=O)NC(=O)NCc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C21H20N2O5/c1-13-16-10-6-7-11-17(16)28-18(13)20(25)27-14(2)19(24)23-21(26)22-12-15-8-4-3-5-9-15/h3-11,14H,12H2,1-2H3,(H2,22,23,24,26)/t14-/m0/s1 |
| InChIKey | FVTIRIRCNCQZRE-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |