C19H16FNO4 — CID 7292203
[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 7292203) has the molecular formula C19H16FNO4 and a molecular weight of 341.34 g/mol. Its IUPAC name is [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7292203 |
| Molecular Formula | C19H16FNO4 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@@H](C)C(=O)Nc2ccccc2F)oc2ccccc12 |
| InChI | InChI=1S/C19H16FNO4/c1-11-13-7-3-6-10-16(13)25-17(11)19(23)24-12(2)18(22)21-15-9-5-4-8-14(15)20/h3-10,12H,1-2H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | PHELZGILXGTEGM-LBPRGKRZSA-N |
| XLogP | 4.06 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |