C20H16F3NO4 — CID 16506354
[1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 16506354) has the molecular formula C20H16F3NO4 and a molecular weight of 391.35 g/mol. Its IUPAC name is [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16506354 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)Nc2cccc(C(F)(F)F)c2)oc2ccccc12 |
| InChI | InChI=1S/C20H16F3NO4/c1-11-15-8-3-4-9-16(15)28-17(11)19(26)27-12(2)18(25)24-14-7-5-6-13(10-14)20(21,22)23/h3-10,12H,1-2H3,(H,24,25) |
| InChIKey | XNSRHCGEFCDGET-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |