C19H18N2O6S — CID 2639610
[(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 2639610) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2639610 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@H](C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)oc2ccccc12 |
| InChI | InChI=1S/C19H18N2O6S/c1-11-15-5-3-4-6-16(15)27-17(11)19(23)26-12(2)18(22)21-13-7-9-14(10-8-13)28(20,24)25/h3-10,12H,1-2H3,(H,21,22)(H2,20,24,25)/t12-/m1/s1 |
| InChIKey | LCUDZTMZTQMAQT-GFCCVEGCSA-N |
| XLogP | 2.57 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |