C21H22N2O7S — CID 16520011
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 16520011) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16520011 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1c(C(=O)OC(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H22N2O7S/c1-3-28-12-17-16-6-4-5-7-18(16)30-19(17)21(25)29-13(2)20(24)23-14-8-10-15(11-9-14)31(22,26)27/h4-11,13H,3,12H2,1-2H3,(H,23,24)(H2,22,26,27) |
| InChIKey | WZHPVJGDENXJCC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |