C19H15ClO4 — CID 7239266
[(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 7239266) has the molecular formula C19H15ClO4 and a molecular weight of 342.78 g/mol. Its IUPAC name is [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7239266 |
| Molecular Formula | C19H15ClO4 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)O[C@H](C)C(=O)c2ccc(Cl)cc2)oc2ccccc12 |
| InChI | InChI=1S/C19H15ClO4/c1-11-15-5-3-4-6-16(15)24-18(11)19(22)23-12(2)17(21)13-7-9-14(20)10-8-13/h3-10,12H,1-2H3/t12-/m1/s1 |
| InChIKey | FRCNIALQTKATAA-GFCCVEGCSA-N |
| XLogP | 4.82 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |