C19H17NO5 — CID 47017295
(2-amino-2-oxo-1-phenylethyl) 5-methoxy-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 47017295) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 5-methoxy-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 47017295 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | COc1ccc2oc(C(=O)OC(C(N)=O)c3ccccc3)c(C)c2c1 |
| InChI | InChI=1S/C19H17NO5/c1-11-14-10-13(23-2)8-9-15(14)24-16(11)19(22)25-17(18(20)21)12-6-4-3-5-7-12/h3-10,17H,1-2H3,(H2,20,21) |
| InChIKey | JQIXOKQBULFLPM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |