C18H26NO3+ — CID 7453067
trimethyl-[(2R,3R)-2-methyl-3-(3-methyl-1-benzofuran-2-carbonyl)oxybutyl]azanium (PubChem CID 7453067) has the molecular formula C18H26NO3+ and a molecular weight of 304.41 g/mol. Its IUPAC name is trimethyl-[(2R,3R)-2-methyl-3-(3-methyl-1-benzofuran-2-carbonyl)oxybutyl]azanium.
| Compound Name | trimethyl-[(2R,3R)-2-methyl-3-(3-methyl-1-benzofuran-2-carbonyl)oxybutyl]azanium |
|---|---|
| PubChem CID | 7453067 |
| Molecular Formula | C18H26NO3+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | trimethyl-[(2R,3R)-2-methyl-3-(3-methyl-1-benzofuran-2-carbonyl)oxybutyl]azanium |
| SMILES | Cc1c(C(=O)O[C@H](C)[C@H](C)C[N+](C)(C)C)oc2ccccc12 |
| InChI | InChI=1S/C18H26NO3/c1-12(11-19(4,5)6)14(3)21-18(20)17-13(2)15-9-7-8-10-16(15)22-17/h7-10,12,14H,11H2,1-6H3/q+1/t12-,14-/m1/s1 |
| InChIKey | VTBOGIBYHAFOLN-TZMCWYRMSA-N |
| XLogP | 3.63 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|