C23H21NO4 — CID 4803163
[2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 4-methylbenzoate (PubChem CID 4803163) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 4-methylbenzoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 4803163 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 4-methylbenzoate |
| SMILES | COc1cccc(NC(=O)C(OC(=O)c2ccc(C)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO4/c1-16-11-13-18(14-12-16)23(26)28-21(17-7-4-3-5-8-17)22(25)24-19-9-6-10-20(15-19)27-2/h3-15,21H,1-2H3,(H,24,25) |
| InChIKey | ZDRBTMBWRCLNTO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |