C25H21Cl2NO4 — CID 3898341
[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 3898341) has the molecular formula C25H21Cl2NO4 and a molecular weight of 470.35 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 3898341 |
| Molecular Formula | C25H21Cl2NO4 |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)CCC(=O)c2ccc(Cl)cc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C25H21Cl2NO4/c1-16-7-12-20(15-21(16)27)28-25(31)24(18-5-3-2-4-6-18)32-23(30)14-13-22(29)17-8-10-19(26)11-9-17/h2-12,15,24H,13-14H2,1H3,(H,28,31) |
| InChIKey | OOCYSILWRSHKDG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |