C21H21ClN2O5 — CID 7750970
[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 7750970) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7750970 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | CCNC(=O)NC(=O)[C@@H](OC(=O)CCC(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H21ClN2O5/c1-2-23-21(28)24-20(27)19(15-6-4-3-5-7-15)29-18(26)13-12-17(25)14-8-10-16(22)11-9-14/h3-11,19H,2,12-13H2,1H3,(H2,23,24,27,28)/t19-/m0/s1 |
| InChIKey | JKCRCBIMVKPEBP-IBGZPJMESA-N |
| XLogP | 3.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |