C20H19FN2O5 — CID 7764456
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 7764456) has the molecular formula C20H19FN2O5 and a molecular weight of 386.38 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7764456 |
| Molecular Formula | C20H19FN2O5 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)CCC(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H19FN2O5/c1-22-20(27)23-19(26)18(14-5-3-2-4-6-14)28-17(25)12-11-16(24)13-7-9-15(21)10-8-13/h2-10,18H,11-12H2,1H3,(H2,22,23,26,27)/t18-/m1/s1 |
| InChIKey | COJRLEPCTYAGSD-GOSISDBHSA-N |
| XLogP | 2.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |