C18H17FN2O4S — CID 7676495
[(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7676495) has the molecular formula C18H17FN2O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7676495 |
| Molecular Formula | C18H17FN2O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | CNC(=O)NC(=O)[C@@H](OC(=O)CSc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H17FN2O4S/c1-20-18(24)21-17(23)16(12-7-3-2-4-8-12)25-15(22)11-26-14-10-6-5-9-13(14)19/h2-10,16H,11H2,1H3,(H2,20,21,23,24)/t16-/m0/s1 |
| InChIKey | ZLSLZXQYILUGID-INIZCTEOSA-N |
| XLogP | 2.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |