C17H22N2O4 — CID 7722501
[(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate (PubChem CID 7722501) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate.
| Compound Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 7722501 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate |
| SMILES | CNC(=O)NC(=O)[C@@H](OC(=O)CC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O4/c1-18-17(22)19-16(21)15(13-9-3-2-4-10-13)23-14(20)11-12-7-5-6-8-12/h2-4,9-10,12,15H,5-8,11H2,1H3,(H2,18,19,21,22)/t15-/m0/s1 |
| InChIKey | DKDQGKASYROGSR-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |