C23H27NO4 — CID 7722308
[(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate (PubChem CID 7722308) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate.
| Compound Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 7722308 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-cyclopentylacetate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](OC(=O)CC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-16-12-13-20(27-2)19(14-16)24-23(26)22(18-10-4-3-5-11-18)28-21(25)15-17-8-6-7-9-17/h3-5,10-14,17,22H,6-9,15H2,1-2H3,(H,24,26)/t22-/m1/s1 |
| InChIKey | CYMCVAZOBIAZTG-JOCHJYFZSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |