C19H21NO5 — CID 8015324
[(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methoxyacetate (PubChem CID 8015324) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methoxyacetate.
| Compound Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 8015324 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@@H](C(=O)Nc1cc(C)ccc1OC)c1ccccc1 |
| InChI | InChI=1S/C19H21NO5/c1-13-9-10-16(24-3)15(11-13)20-19(22)18(25-17(21)12-23-2)14-7-5-4-6-8-14/h4-11,18H,12H2,1-3H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | HVNBFQXEECJDJC-GOSISDBHSA-N |
| XLogP | 2.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |