C20H21NO4 — CID 2507805
[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-but-2-enoate (PubChem CID 2507805) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-but-2-enoate.
| Compound Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 2507805 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H](C(=O)Nc1cc(C)ccc1OC)c1ccccc1 |
| InChI | InChI=1S/C20H21NO4/c1-4-8-18(22)25-19(15-9-6-5-7-10-15)20(23)21-16-13-14(2)11-12-17(16)24-3/h4-13,19H,1-3H3,(H,21,23)/b8-4+/t19-/m0/s1 |
| InChIKey | NVQUBJZEPXPHOA-AMGQUURNSA-N |
| XLogP | 3.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|