C25H22FNO4 — CID 7779757
[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 7779757) has the molecular formula C25H22FNO4 and a molecular weight of 419.45 g/mol. Its IUPAC name is [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7779757 |
| Molecular Formula | C25H22FNO4 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H](OC(=O)/C=C/c1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C25H22FNO4/c1-17-11-13-22(30-2)21(15-17)27-25(29)24(19-8-4-3-5-9-19)31-23(28)14-12-18-7-6-10-20(26)16-18/h3-16,24H,1-2H3,(H,27,29)/b14-12+/t24-/m0/s1 |
| InChIKey | BFRISBRFSSUYSG-ZOBSEURRSA-N |
| XLogP | 5.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|