C19H17ClFNO4 — CID 7779971
[(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 7779971) has the molecular formula C19H17ClFNO4 and a molecular weight of 377.80 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7779971 |
| Molecular Formula | C19H17ClFNO4 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@@H](C)OC(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C19H17ClFNO4/c1-12(19(24)22-16-11-14(20)7-8-17(16)25-2)26-18(23)9-6-13-4-3-5-15(21)10-13/h3-12H,1-2H3,(H,22,24)/b9-6+/t12-/m1/s1 |
| InChIKey | QDSPADOLLLKFCK-UVMWJGKXSA-N |
| XLogP | 4.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|