C20H18Cl2FNO3 — CID 7786136
[(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 7786136) has the molecular formula C20H18Cl2FNO3 and a molecular weight of 410.27 g/mol. Its IUPAC name is [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7786136 |
| Molecular Formula | C20H18Cl2FNO3 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1cccc(F)c1)C(=O)N[C@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H18Cl2FNO3/c1-12(17-8-7-15(21)11-18(17)22)24-20(26)13(2)27-19(25)9-6-14-4-3-5-16(23)10-14/h3-13H,1-2H3,(H,24,26)/b9-6+/t12-,13-/m1/s1 |
| InChIKey | NKUHERWFKHHOJX-BHAGLWOSSA-N |
| XLogP | 4.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|