C17H20FNO3 — CID 8021314
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 8021314) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8021314 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1cccc(F)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H20FNO3/c1-12(17(21)19-15-7-2-3-8-15)22-16(20)10-9-13-5-4-6-14(18)11-13/h4-6,9-12,15H,2-3,7-8H2,1H3,(H,19,21)/b10-9+/t12-/m0/s1 |
| InChIKey | GORBZYKIACNIBH-VMPCVLLUSA-N |
| XLogP | 2.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|