C16H17FN2O4 — CID 46658393
[1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 46658393) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46658393 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1cccc(F)c1)C(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C16H17FN2O4/c1-10(15(21)19-16(22)18-13-6-7-13)23-14(20)8-5-11-3-2-4-12(17)9-11/h2-5,8-10,13H,6-7H2,1H3,(H2,18,19,21,22)/b8-5+ |
| InChIKey | FXKSTUWGCJGMKK-VMPITWQZSA-N |
| XLogP | 1.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|