C19H22ClFN2O4 — CID 7880824
[(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7880824) has the molecular formula C19H22ClFN2O4 and a molecular weight of 396.85 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7880824 |
| Molecular Formula | C19H22ClFN2O4 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(F)c(Cl)c1)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H22ClFN2O4/c1-12(18(25)23-19(26)22-14-5-3-2-4-6-14)27-17(24)10-8-13-7-9-16(21)15(20)11-13/h7-12,14H,2-6H2,1H3,(H2,22,23,25,26)/b10-8+/t12-/m0/s1 |
| InChIKey | HSLBMIBJULKQRH-OANVXVOSSA-N |
| XLogP | 3.58 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|