C16H19Cl2NO3 — CID 8760068
[(2R)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-methylbut-2-enoate (PubChem CID 8760068) has the molecular formula C16H19Cl2NO3 and a molecular weight of 344.24 g/mol. Its IUPAC name is [(2R)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-methylbut-2-enoate.
| Compound Name | [(2R)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 8760068 |
| Molecular Formula | C16H19Cl2NO3 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [(2R)-1-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@H](C)C(=O)N[C@@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2NO3/c1-9(2)7-15(20)22-11(4)16(21)19-10(3)13-6-5-12(17)8-14(13)18/h5-8,10-11H,1-4H3,(H,19,21)/t10-,11+/m0/s1 |
| InChIKey | GGZHYJUABMZDIQ-WDEREUQCSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|