C11H12Cl3NO — CID 2118112
(2S)-2-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]propanamide (PubChem CID 2118112) has the molecular formula C11H12Cl3NO and a molecular weight of 280.58 g/mol. Its IUPAC name is (2S)-2-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]propanamide.
| Compound Name | (2S)-2-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 2118112 |
| Molecular Formula | C11H12Cl3NO |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | (2S)-2-chloro-N-[(1S)-1-(2,4-dichlorophenyl)ethyl]propanamide |
| SMILES | C[C@H](Cl)C(=O)N[C@@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NO/c1-6(12)11(16)15-7(2)9-4-3-8(13)5-10(9)14/h3-7H,1-2H3,(H,15,16)/t6-,7-/m0/s1 |
| InChIKey | LGSHJXQUNJYFNJ-BQBZGAKWSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|