C10H11Cl2N3O2 — CID 43163867
N-[1-(2,4-dichlorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide (PubChem CID 43163867) has the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 43163867 |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide |
| SMILES | CC(NC(=O)C(=O)NN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O2/c1-5(14-9(16)10(17)15-13)7-3-2-6(11)4-8(7)12/h2-5H,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | NKSXXQLMDLEOAH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|