C16H16Cl2N2O — CID 104897119
(2S)-2-amino-N-[1-(2,4-dichlorophenyl)ethyl]-2-phenylacetamide (PubChem CID 104897119) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(2,4-dichlorophenyl)ethyl]-2-phenylacetamide.
| Compound Name | (2S)-2-amino-N-[1-(2,4-dichlorophenyl)ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 104897119 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (2S)-2-amino-N-[1-(2,4-dichlorophenyl)ethyl]-2-phenylacetamide |
| SMILES | CC(NC(=O)[C@@H](N)c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O/c1-10(13-8-7-12(17)9-14(13)18)20-16(21)15(19)11-5-3-2-4-6-11/h2-10,15H,19H2,1H3,(H,20,21)/t10?,15-/m0/s1 |
| InChIKey | GMEAVFMUMAETDR-WRXSAAJRSA-N |
| XLogP | 3.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |