C20H22Cl2N2O2 — CID 97088982
N'-[(1R)-1-(2,4-dichlorophenyl)ethyl]-N-[(1S)-1-phenylethyl]butanediamide (PubChem CID 97088982) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is N'-[(1R)-1-(2,4-dichlorophenyl)ethyl]-N-[(1S)-1-phenylethyl]butanediamide.
| Compound Name | N'-[(1R)-1-(2,4-dichlorophenyl)ethyl]-N-[(1S)-1-phenylethyl]butanediamide |
|---|---|
| PubChem CID | 97088982 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N'-[(1R)-1-(2,4-dichlorophenyl)ethyl]-N-[(1S)-1-phenylethyl]butanediamide |
| SMILES | C[C@H](NC(=O)CCC(=O)N[C@H](C)c1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-13(15-6-4-3-5-7-15)23-19(25)10-11-20(26)24-14(2)17-9-8-16(21)12-18(17)22/h3-9,12-14H,10-11H2,1-2H3,(H,23,25)(H,24,26)/t13-,14+/m0/s1 |
| InChIKey | OVPSVLAJFOJCIS-UONOGXRCSA-N |
| XLogP | 4.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |