C17H17Cl2NO — CID 9441522
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-phenylpropanamide (PubChem CID 9441522) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-phenylpropanamide.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 9441522 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3-phenylpropanamide |
| SMILES | C[C@@H](NC(=O)CCc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2NO/c1-12(15-9-8-14(18)11-16(15)19)20-17(21)10-7-13-5-3-2-4-6-13/h2-6,8-9,11-12H,7,10H2,1H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | ZSTJBEIBOWVURC-GFCCVEGCSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |